C16H25N4O3S+ — CID 8002045
1-[(Z)-(2,4-dimethoxyphenyl)methylideneamino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea (PubChem CID 8002045) has the molecular formula C16H25N4O3S+ and a molecular weight of 353.47 g/mol. Its IUPAC name is 1-[(Z)-(2,4-dimethoxyphenyl)methylideneamino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea.
| Compound Name | 1-[(Z)-(2,4-dimethoxyphenyl)methylideneamino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 8002045 |
| Molecular Formula | C16H25N4O3S+ |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 1-[(Z)-(2,4-dimethoxyphenyl)methylideneamino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
| SMILES | COc1ccc(/C=N\NC(=S)NCC[NH+]2CCOCC2)c(OC)c1 |
| InChI | InChI=1S/C16H24N4O3S/c1-21-14-4-3-13(15(11-14)22-2)12-18-19-16(24)17-5-6-20-7-9-23-10-8-20/h3-4,11-12H,5-10H2,1-2H3,(H2,17,19,24)/p+1/b18-12- |
| InChIKey | JZNPXXAOXNHORM-PDGQHHTCSA-O |
| XLogP | -0.58 |
| TPSA | 68.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|