C18H32N5OS+ — CID 7934096
1-[(Z)-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]methylideneamino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea (PubChem CID 7934096) has the molecular formula C18H32N5OS+ and a molecular weight of 366.56 g/mol. Its IUPAC name is 1-[(Z)-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]methylideneamino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea.
| Compound Name | 1-[(Z)-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]methylideneamino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 7934096 |
| Molecular Formula | C18H32N5OS+ |
| Molecular Weight | 366.56 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 1-[(Z)-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]methylideneamino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
| SMILES | Cc1cc(/C=N\NC(=S)NCC[NH+]2CCOCC2)c(C)n1CC(C)C |
| InChI | InChI=1S/C18H31N5OS/c1-14(2)13-23-15(3)11-17(16(23)4)12-20-21-18(25)19-5-6-22-7-9-24-10-8-22/h11-12,14H,5-10,13H2,1-4H3,(H2,19,21,25)/p+1/b20-12- |
| InChIKey | WVWYGPOPQMTGKX-NDENLUEZSA-O |
| XLogP | 0.47 |
| TPSA | 55.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.56 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|