C13H24N5OS+ — CID 8538603
1-(2-morpholin-4-ium-4-ylethyl)-3-(1,3,5-trimethylpyrazol-4-yl)thiourea (PubChem CID 8538603) has the molecular formula C13H24N5OS+ and a molecular weight of 298.44 g/mol. Its IUPAC name is 1-(2-morpholin-4-ium-4-ylethyl)-3-(1,3,5-trimethylpyrazol-4-yl)thiourea.
| Compound Name | 1-(2-morpholin-4-ium-4-ylethyl)-3-(1,3,5-trimethylpyrazol-4-yl)thiourea |
|---|---|
| PubChem CID | 8538603 |
| Molecular Formula | C13H24N5OS+ |
| Molecular Weight | 298.44 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 1-(2-morpholin-4-ium-4-ylethyl)-3-(1,3,5-trimethylpyrazol-4-yl)thiourea |
| SMILES | Cc1nn(C)c(C)c1NC(=S)NCC[NH+]1CCOCC1 |
| InChI | InChI=1S/C13H23N5OS/c1-10-12(11(2)17(3)16-10)15-13(20)14-4-5-18-6-8-19-9-7-18/h4-9H2,1-3H3,(H2,14,15,20)/p+1 |
| InChIKey | OUBYKOGZTXLEKE-UHFFFAOYSA-O |
| XLogP | -0.76 |
| TPSA | 55.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.44 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|