C13H19FN3OS+ — CID 7303712
1-(2-fluorophenyl)-3-(2-morpholin-4-ium-4-ylethyl)thiourea (PubChem CID 7303712) has the molecular formula C13H19FN3OS+ and a molecular weight of 284.38 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-(2-morpholin-4-ium-4-ylethyl)thiourea.
| Compound Name | 1-(2-fluorophenyl)-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 7303712 |
| Molecular Formula | C13H19FN3OS+ |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 1-(2-fluorophenyl)-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
| SMILES | Fc1ccccc1NC(=S)NCC[NH+]1CCOCC1 |
| InChI | InChI=1S/C13H18FN3OS/c14-11-3-1-2-4-12(11)16-13(19)15-5-6-17-7-9-18-10-8-17/h1-4H,5-10H2,(H2,15,16,19)/p+1 |
| InChIKey | ZCTWUUQODZVMDE-UHFFFAOYSA-O |
| XLogP | 0.03 |
| TPSA | 37.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|