C17H28N3O2S+ — CID 8683726
1-(3-morpholin-4-ium-4-ylpropyl)-3-(2-propoxyphenyl)thiourea (PubChem CID 8683726) has the molecular formula C17H28N3O2S+ and a molecular weight of 338.50 g/mol. Its IUPAC name is 1-(3-morpholin-4-ium-4-ylpropyl)-3-(2-propoxyphenyl)thiourea.
| Compound Name | 1-(3-morpholin-4-ium-4-ylpropyl)-3-(2-propoxyphenyl)thiourea |
|---|---|
| PubChem CID | 8683726 |
| Molecular Formula | C17H28N3O2S+ |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 1-(3-morpholin-4-ium-4-ylpropyl)-3-(2-propoxyphenyl)thiourea |
| SMILES | CCCOc1ccccc1NC(=S)NCCC[NH+]1CCOCC1 |
| InChI | InChI=1S/C17H27N3O2S/c1-2-12-22-16-7-4-3-6-15(16)19-17(23)18-8-5-9-20-10-13-21-14-11-20/h3-4,6-7H,2,5,8-14H2,1H3,(H2,18,19,23)/p+1 |
| InChIKey | XZFMPKZBNVTPIK-UHFFFAOYSA-O |
| XLogP | 1.07 |
| TPSA | 46.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|