C19H32N3O3S+ — CID 8660333
1-(3,4-dipropoxyphenyl)-3-(2-morpholin-4-ium-4-ylethyl)thiourea (PubChem CID 8660333) has the molecular formula C19H32N3O3S+ and a molecular weight of 382.55 g/mol. Its IUPAC name is 1-(3,4-dipropoxyphenyl)-3-(2-morpholin-4-ium-4-ylethyl)thiourea.
| Compound Name | 1-(3,4-dipropoxyphenyl)-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 8660333 |
| Molecular Formula | C19H32N3O3S+ |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | 1-(3,4-dipropoxyphenyl)-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
| SMILES | CCCOc1ccc(NC(=S)NCC[NH+]2CCOCC2)cc1OCCC |
| InChI | InChI=1S/C19H31N3O3S/c1-3-11-24-17-6-5-16(15-18(17)25-12-4-2)21-19(26)20-7-8-22-9-13-23-14-10-22/h5-6,15H,3-4,7-14H2,1-2H3,(H2,20,21,26)/p+1 |
| InChIKey | XLSATBFGCHIREZ-UHFFFAOYSA-O |
| XLogP | 1.47 |
| TPSA | 56.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|