C19H31N3O3S — CID 8660334
1-(3,4-dipropoxyphenyl)-3-(2-morpholin-4-ylethyl)thiourea (PubChem CID 8660334) has the molecular formula C19H31N3O3S and a molecular weight of 381.54 g/mol. Its IUPAC name is 1-(3,4-dipropoxyphenyl)-3-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-(3,4-dipropoxyphenyl)-3-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 8660334 |
| Molecular Formula | C19H31N3O3S |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 1-(3,4-dipropoxyphenyl)-3-(2-morpholin-4-ylethyl)thiourea |
| SMILES | CCCOc1ccc(NC(=S)NCCN2CCOCC2)cc1OCCC |
| InChI | InChI=1S/C19H31N3O3S/c1-3-11-24-17-6-5-16(15-18(17)25-12-4-2)21-19(26)20-7-8-22-9-13-23-14-10-22/h5-6,15H,3-4,7-14H2,1-2H3,(H2,20,21,26) |
| InChIKey | XLSATBFGCHIREZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 54.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|