C24H32N4O3S — CID 110508421
1-[(E)-[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea (PubChem CID 110508421) has the molecular formula C24H32N4O3S and a molecular weight of 456.61 g/mol. Its IUPAC name is 1-[(E)-[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-[(E)-[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 110508421 |
| Molecular Formula | C24H32N4O3S |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 1-[(E)-[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea |
| SMILES | CCOc1cc(/C=N/NC(=S)NCCN2CCOCC2)ccc1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C24H32N4O3S/c1-3-30-23-16-21(8-9-22(23)31-18-20-6-4-19(2)5-7-20)17-26-27-24(32)25-10-11-28-12-14-29-15-13-28/h4-9,16-17H,3,10-15,18H2,1-2H3,(H2,25,27,32)/b26-17+ |
| InChIKey | TYAJAHUKPZETTQ-YZSQISJMSA-N |
| XLogP | 3.10 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|