C19H29ClN4O3S — CID 110508462
1-[(E)-(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea (PubChem CID 110508462) has the molecular formula C19H29ClN4O3S and a molecular weight of 428.99 g/mol. Its IUPAC name is 1-[(E)-(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-[(E)-(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 110508462 |
| Molecular Formula | C19H29ClN4O3S |
| Molecular Weight | 428.99 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 1-[(E)-(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea |
| SMILES | CCOc1cc(/C=N/NC(=S)NCCN2CCOCC2)cc(Cl)c1OC(C)C |
| InChI | InChI=1S/C19H29ClN4O3S/c1-4-26-17-12-15(11-16(20)18(17)27-14(2)3)13-22-23-19(28)21-5-6-24-7-9-25-10-8-24/h11-14H,4-10H2,1-3H3,(H2,21,23,28)/b22-13+ |
| InChIKey | JIDBMNGMHIIAIQ-LPYMAVHISA-N |
| XLogP | 2.66 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.99 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|