C20H30BrN5O4S — CID 6038027
2-[2-bromo-6-ethoxy-4-[(Z)-(2-morpholin-4-ylethylcarbamothioylhydrazinylidene)methyl]phenoxy]-N,N-dimethylacetamide (PubChem CID 6038027) has the molecular formula C20H30BrN5O4S and a molecular weight of 516.46 g/mol. Its IUPAC name is 2-[2-bromo-6-ethoxy-4-[(Z)-(2-morpholin-4-ylethylcarbamothioylhydrazinylidene)methyl]phenoxy]-N,N-dimethylacetamide.
| Compound Name | 2-[2-bromo-6-ethoxy-4-[(Z)-(2-morpholin-4-ylethylcarbamothioylhydrazinylidene)methyl]phenoxy]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 6038027 |
| Molecular Formula | C20H30BrN5O4S |
| Molecular Weight | 516.46 g/mol |
| Exact Mass | 515.12 |
| IUPAC Name | 2-[2-bromo-6-ethoxy-4-[(Z)-(2-morpholin-4-ylethylcarbamothioylhydrazinylidene)methyl]phenoxy]-N,N-dimethylacetamide |
| SMILES | CCOc1cc(/C=N\NC(=S)NCCN2CCOCC2)cc(Br)c1OCC(=O)N(C)C |
| InChI | InChI=1S/C20H30BrN5O4S/c1-4-29-17-12-15(11-16(21)19(17)30-14-18(27)25(2)3)13-23-24-20(31)22-5-6-26-7-9-28-10-8-26/h11-13H,4-10,14H2,1-3H3,(H2,22,24,31)/b23-13- |
| InChIKey | NCWDGHIMBKUOLV-QRVIBDJDSA-N |
| XLogP | 1.45 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.46 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|