C22H27BrN4O3S — CID 16553587
2-[2-bromo-4-[(E)-[(2,6-dimethylphenyl)carbamothioylhydrazinylidene]methyl]-6-ethoxyphenoxy]-N,N-dimethylacetamide (PubChem CID 16553587) has the molecular formula C22H27BrN4O3S and a molecular weight of 507.45 g/mol. Its IUPAC name is 2-[2-bromo-4-[(E)-[(2,6-dimethylphenyl)carbamothioylhydrazinylidene]methyl]-6-ethoxyphenoxy]-N,N-dimethylacetamide.
| Compound Name | 2-[2-bromo-4-[(E)-[(2,6-dimethylphenyl)carbamothioylhydrazinylidene]methyl]-6-ethoxyphenoxy]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 16553587 |
| Molecular Formula | C22H27BrN4O3S |
| Molecular Weight | 507.45 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | 2-[2-bromo-4-[(E)-[(2,6-dimethylphenyl)carbamothioylhydrazinylidene]methyl]-6-ethoxyphenoxy]-N,N-dimethylacetamide |
| SMILES | CCOc1cc(/C=N/NC(=S)Nc2c(C)cccc2C)cc(Br)c1OCC(=O)N(C)C |
| InChI | InChI=1S/C22H27BrN4O3S/c1-6-29-18-11-16(10-17(23)21(18)30-13-19(28)27(4)5)12-24-26-22(31)25-20-14(2)8-7-9-15(20)3/h7-12H,6,13H2,1-5H3,(H2,25,26,31)/b24-12+ |
| InChIKey | SPDVEBQUWZHVHI-WYMPLXKRSA-N |
| XLogP | 4.25 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|