C20H22BrFN4O3S — CID 4002096
2-[2-bromo-6-ethoxy-4-[(ethylcarbamothioylhydrazinylidene)methyl]phenoxy]-N-(4-fluorophenyl)acetamide (PubChem CID 4002096) has the molecular formula C20H22BrFN4O3S and a molecular weight of 497.39 g/mol. Its IUPAC name is 2-[2-bromo-6-ethoxy-4-[(ethylcarbamothioylhydrazinylidene)methyl]phenoxy]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[2-bromo-6-ethoxy-4-[(ethylcarbamothioylhydrazinylidene)methyl]phenoxy]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 4002096 |
| Molecular Formula | C20H22BrFN4O3S |
| Molecular Weight | 497.39 g/mol |
| Exact Mass | 496.06 |
| IUPAC Name | 2-[2-bromo-6-ethoxy-4-[(ethylcarbamothioylhydrazinylidene)methyl]phenoxy]-N-(4-fluorophenyl)acetamide |
| SMILES | CCNC(=S)NN=Cc1cc(Br)c(OCC(=O)Nc2ccc(F)cc2)c(OCC)c1 |
| InChI | InChI=1S/C20H22BrFN4O3S/c1-3-23-20(30)26-24-11-13-9-16(21)19(17(10-13)28-4-2)29-12-18(27)25-15-7-5-14(22)6-8-15/h5-11H,3-4,12H2,1-2H3,(H,25,27)(H2,23,26,30) |
| InChIKey | MYKDKKWWGVCEFS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|