C19H18BrFN4O5 — CID 126157083
N'-[(Z)-[3-bromo-4-[2-(4-fluoroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-N-methyloxamide (PubChem CID 126157083) has the molecular formula C19H18BrFN4O5 and a molecular weight of 481.28 g/mol. Its IUPAC name is N'-[(Z)-[3-bromo-4-[2-(4-fluoroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-N-methyloxamide.
| Compound Name | N'-[(Z)-[3-bromo-4-[2-(4-fluoroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-N-methyloxamide |
|---|---|
| PubChem CID | 126157083 |
| Molecular Formula | C19H18BrFN4O5 |
| Molecular Weight | 481.28 g/mol |
| Exact Mass | 480.04 |
| IUPAC Name | N'-[(Z)-[3-bromo-4-[2-(4-fluoroanilino)-2-oxoethoxy]-5-methoxyphenyl]methylideneamino]-N-methyloxamide |
| SMILES | CNC(=O)C(=O)N/N=C\c1cc(Br)c(OCC(=O)Nc2ccc(F)cc2)c(OC)c1 |
| InChI | InChI=1S/C19H18BrFN4O5/c1-22-18(27)19(28)25-23-9-11-7-14(20)17(15(8-11)29-2)30-10-16(26)24-13-5-3-12(21)4-6-13/h3-9H,10H2,1-2H3,(H,22,27)(H,24,26)(H,25,28)/b23-9- |
| InChIKey | DSVNAHFUVPMGDO-AQHIEDMUSA-N |
| XLogP | 1.81 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.28 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|