C29H25BrFN3O5 — CID 126377442
N-[(Z)-[3-bromo-5-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-methoxynaphthalene-2-carboxamide (PubChem CID 126377442) has the molecular formula C29H25BrFN3O5 and a molecular weight of 594.44 g/mol. Its IUPAC name is N-[(Z)-[3-bromo-5-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-methoxynaphthalene-2-carboxamide.
| Compound Name | N-[(Z)-[3-bromo-5-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-methoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 126377442 |
| Molecular Formula | C29H25BrFN3O5 |
| Molecular Weight | 594.44 g/mol |
| Exact Mass | 593.10 |
| IUPAC Name | N-[(Z)-[3-bromo-5-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-3-methoxynaphthalene-2-carboxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)c2cc3ccccc3cc2OC)cc(Br)c1OCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C29H25BrFN3O5/c1-3-38-26-13-18(12-24(30)28(26)39-17-27(35)33-22-10-8-21(31)9-11-22)16-32-34-29(36)23-14-19-6-4-5-7-20(19)15-25(23)37-2/h4-16H,3,17H2,1-2H3,(H,33,35)(H,34,36)/b32-16- |
| InChIKey | KXXYLGTXNOVYHR-ZMGVVAQMSA-N |
| XLogP | 5.93 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.44 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|