C25H27BrN2O4 — CID 124551216
N-[(Z)-[3-bromo-4-[(2S)-butan-2-yl]oxy-5-ethoxyphenyl]methylideneamino]-3-methoxynaphthalene-2-carboxamide (PubChem CID 124551216) has the molecular formula C25H27BrN2O4 and a molecular weight of 499.41 g/mol. Its IUPAC name is N-[(Z)-[3-bromo-4-[(2S)-butan-2-yl]oxy-5-ethoxyphenyl]methylideneamino]-3-methoxynaphthalene-2-carboxamide.
| Compound Name | N-[(Z)-[3-bromo-4-[(2S)-butan-2-yl]oxy-5-ethoxyphenyl]methylideneamino]-3-methoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 124551216 |
| Molecular Formula | C25H27BrN2O4 |
| Molecular Weight | 499.41 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | N-[(Z)-[3-bromo-4-[(2S)-butan-2-yl]oxy-5-ethoxyphenyl]methylideneamino]-3-methoxynaphthalene-2-carboxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)c2cc3ccccc3cc2OC)cc(Br)c1O[C@@H](C)CC |
| InChI | InChI=1S/C25H27BrN2O4/c1-5-16(3)32-24-21(26)11-17(12-23(24)31-6-2)15-27-28-25(29)20-13-18-9-7-8-10-19(18)14-22(20)30-4/h7-16H,5-6H2,1-4H3,(H,28,29)/b27-15-/t16-/m0/s1 |
| InChIKey | WWIFRKFVNHEDIK-DGLVQCRBSA-N |
| XLogP | 5.95 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.41 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|