C26H19Br2ClN2O3 — CID 126378284
N-[(Z)-[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-3-methoxynaphthalene-2-carboxamide (PubChem CID 126378284) has the molecular formula C26H19Br2ClN2O3 and a molecular weight of 602.71 g/mol. Its IUPAC name is N-[(Z)-[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-3-methoxynaphthalene-2-carboxamide.
| Compound Name | N-[(Z)-[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-3-methoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 126378284 |
| Molecular Formula | C26H19Br2ClN2O3 |
| Molecular Weight | 602.71 g/mol |
| Exact Mass | 599.95 |
| IUPAC Name | N-[(Z)-[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-3-methoxynaphthalene-2-carboxamide |
| SMILES | COc1cc2ccccc2cc1C(=O)N/N=C\c1cc(Br)c(OCc2ccc(Cl)cc2)c(Br)c1 |
| InChI | InChI=1S/C26H19Br2ClN2O3/c1-33-24-13-19-5-3-2-4-18(19)12-21(24)26(32)31-30-14-17-10-22(27)25(23(28)11-17)34-15-16-6-8-20(29)9-7-16/h2-14H,15H2,1H3,(H,31,32)/b30-14- |
| InChIKey | SMZXBIUBIIGZRY-CPDSRJINSA-N |
| XLogP | 7.37 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.71 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|