C18H19BrN4O2S — CID 6174493
2-[2-bromo-4-[(Z)-(ethylcarbamothioylhydrazinylidene)methyl]phenoxy]-N-phenylacetamide (PubChem CID 6174493) has the molecular formula C18H19BrN4O2S and a molecular weight of 435.35 g/mol. Its IUPAC name is 2-[2-bromo-4-[(Z)-(ethylcarbamothioylhydrazinylidene)methyl]phenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-bromo-4-[(Z)-(ethylcarbamothioylhydrazinylidene)methyl]phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 6174493 |
| Molecular Formula | C18H19BrN4O2S |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | 2-[2-bromo-4-[(Z)-(ethylcarbamothioylhydrazinylidene)methyl]phenoxy]-N-phenylacetamide |
| SMILES | CCNC(=S)N/N=C\c1ccc(OCC(=O)Nc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C18H19BrN4O2S/c1-2-20-18(26)23-21-11-13-8-9-16(15(19)10-13)25-12-17(24)22-14-6-4-3-5-7-14/h3-11H,2,12H2,1H3,(H,22,24)(H2,20,23,26)/b21-11- |
| InChIKey | XZAHCJQDTABNLC-NHDPSOOVSA-N |
| XLogP | 3.28 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|