C19H21BrN4O3S — CID 6185154
2-[5-bromo-4-[(Z)-(ethylcarbamothioylhydrazinylidene)methyl]-2-methoxyphenoxy]-N-phenylacetamide (PubChem CID 6185154) has the molecular formula C19H21BrN4O3S and a molecular weight of 465.37 g/mol. Its IUPAC name is 2-[5-bromo-4-[(Z)-(ethylcarbamothioylhydrazinylidene)methyl]-2-methoxyphenoxy]-N-phenylacetamide.
| Compound Name | 2-[5-bromo-4-[(Z)-(ethylcarbamothioylhydrazinylidene)methyl]-2-methoxyphenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 6185154 |
| Molecular Formula | C19H21BrN4O3S |
| Molecular Weight | 465.37 g/mol |
| Exact Mass | 464.05 |
| IUPAC Name | 2-[5-bromo-4-[(Z)-(ethylcarbamothioylhydrazinylidene)methyl]-2-methoxyphenoxy]-N-phenylacetamide |
| SMILES | CCNC(=S)N/N=C\c1cc(OC)c(OCC(=O)Nc2ccccc2)cc1Br |
| InChI | InChI=1S/C19H21BrN4O3S/c1-3-21-19(28)24-22-11-13-9-16(26-2)17(10-15(13)20)27-12-18(25)23-14-7-5-4-6-8-14/h4-11H,3,12H2,1-2H3,(H,23,25)(H2,21,24,28)/b22-11- |
| InChIKey | SAKOBTJAHUWZFU-JJFYIABZSA-N |
| XLogP | 3.29 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|