C28H24BrN3O5 — CID 4651004
N-[[4-(2-anilino-2-oxoethoxy)-2-bromo-5-ethoxyphenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide (PubChem CID 4651004) has the molecular formula C28H24BrN3O5 and a molecular weight of 562.42 g/mol. Its IUPAC name is N-[[4-(2-anilino-2-oxoethoxy)-2-bromo-5-ethoxyphenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-[[4-(2-anilino-2-oxoethoxy)-2-bromo-5-ethoxyphenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 4651004 |
| Molecular Formula | C28H24BrN3O5 |
| Molecular Weight | 562.42 g/mol |
| Exact Mass | 561.09 |
| IUPAC Name | N-[[4-(2-anilino-2-oxoethoxy)-2-bromo-5-ethoxyphenyl]methylideneamino]-3-hydroxynaphthalene-2-carboxamide |
| SMILES | CCOc1cc(C=NNC(=O)c2cc3ccccc3cc2O)c(Br)cc1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C28H24BrN3O5/c1-2-36-25-14-20(23(29)15-26(25)37-17-27(34)31-21-10-4-3-5-11-21)16-30-32-28(35)22-12-18-8-6-7-9-19(18)13-24(22)33/h3-16,33H,2,17H2,1H3,(H,31,34)(H,32,35) |
| InChIKey | XPZDXKRAKXTTML-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.42 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|