C19H21ClN4O2S — CID 4045866
2-[2-chloro-4-[(ethylcarbamothioylhydrazinylidene)methyl]phenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 4045866) has the molecular formula C19H21ClN4O2S and a molecular weight of 404.92 g/mol. Its IUPAC name is 2-[2-chloro-4-[(ethylcarbamothioylhydrazinylidene)methyl]phenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-chloro-4-[(ethylcarbamothioylhydrazinylidene)methyl]phenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 4045866 |
| Molecular Formula | C19H21ClN4O2S |
| Molecular Weight | 404.92 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 2-[2-chloro-4-[(ethylcarbamothioylhydrazinylidene)methyl]phenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | CCNC(=S)NN=Cc1ccc(OCC(=O)Nc2ccc(C)cc2)c(Cl)c1 |
| InChI | InChI=1S/C19H21ClN4O2S/c1-3-21-19(27)24-22-11-14-6-9-17(16(20)10-14)26-12-18(25)23-15-7-4-13(2)5-8-15/h4-11H,3,12H2,1-2H3,(H,23,25)(H2,21,24,27) |
| InChIKey | RCSGMILEUCZUTC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.92 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|