C24H20Cl2N4O4 — CID 126170389
N'-[(Z)-[3-chloro-4-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-methylphenyl)oxamide (PubChem CID 126170389) has the molecular formula C24H20Cl2N4O4 and a molecular weight of 499.35 g/mol. Its IUPAC name is N'-[(Z)-[3-chloro-4-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-methylphenyl)oxamide.
| Compound Name | N'-[(Z)-[3-chloro-4-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-methylphenyl)oxamide |
|---|---|
| PubChem CID | 126170389 |
| Molecular Formula | C24H20Cl2N4O4 |
| Molecular Weight | 499.35 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | N'-[(Z)-[3-chloro-4-[2-(2-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(4-methylphenyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)N/N=C\c2ccc(OCC(=O)Nc3ccccc3Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C24H20Cl2N4O4/c1-15-6-9-17(10-7-15)28-23(32)24(33)30-27-13-16-8-11-21(19(26)12-16)34-14-22(31)29-20-5-3-2-4-18(20)25/h2-13H,14H2,1H3,(H,28,32)(H,29,31)(H,30,33)/b27-13- |
| InChIKey | CKZGBNZHLGEOII-WKIKZPBSSA-N |
| XLogP | 4.41 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.35 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|