C17H13Cl2N3O5 — CID 8989828
2-[2-chloro-4-[(Z)-[[2-(2-chloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 8989828) has the molecular formula C17H13Cl2N3O5 and a molecular weight of 410.21 g/mol. Its IUPAC name is 2-[2-chloro-4-[(Z)-[[2-(2-chloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-chloro-4-[(Z)-[[2-(2-chloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 8989828 |
| Molecular Formula | C17H13Cl2N3O5 |
| Molecular Weight | 410.21 g/mol |
| Exact Mass | 409.02 |
| IUPAC Name | 2-[2-chloro-4-[(Z)-[[2-(2-chloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(/C=N\NC(=O)C(=O)Nc2ccccc2Cl)cc1Cl |
| InChI | InChI=1S/C17H13Cl2N3O5/c18-11-3-1-2-4-13(11)21-16(25)17(26)22-20-8-10-5-6-14(12(19)7-10)27-9-15(23)24/h1-8H,9H2,(H,21,25)(H,22,26)(H,23,24)/b20-8- |
| InChIKey | MJKKYTTZJSFNIW-ZBKNUEDVSA-N |
| XLogP | 2.55 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.21 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|