C18H15ClN2O7 — CID 4205853
2-[2-(carboxymethoxy)-4-[[(2-chlorobenzoyl)hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 4205853) has the molecular formula C18H15ClN2O7 and a molecular weight of 406.78 g/mol. Its IUPAC name is 2-[2-(carboxymethoxy)-4-[[(2-chlorobenzoyl)hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-(carboxymethoxy)-4-[[(2-chlorobenzoyl)hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 4205853 |
| Molecular Formula | C18H15ClN2O7 |
| Molecular Weight | 406.78 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 2-[2-(carboxymethoxy)-4-[[(2-chlorobenzoyl)hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(C=NNC(=O)c2ccccc2Cl)cc1OCC(=O)O |
| InChI | InChI=1S/C18H15ClN2O7/c19-13-4-2-1-3-12(13)18(26)21-20-8-11-5-6-14(27-9-16(22)23)15(7-11)28-10-17(24)25/h1-8H,9-10H2,(H,21,26)(H,22,23)(H,24,25) |
| InChIKey | QRVLKGNNYPUQLV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 134.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.78 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|