C12H13ClN4O4 — CID 8990228
N'-[(Z)-[4-(2-amino-2-oxoethoxy)-3-chlorophenyl]methylideneamino]-N-methyloxamide (PubChem CID 8990228) has the molecular formula C12H13ClN4O4 and a molecular weight of 312.71 g/mol. Its IUPAC name is N'-[(Z)-[4-(2-amino-2-oxoethoxy)-3-chlorophenyl]methylideneamino]-N-methyloxamide.
| Compound Name | N'-[(Z)-[4-(2-amino-2-oxoethoxy)-3-chlorophenyl]methylideneamino]-N-methyloxamide |
|---|---|
| PubChem CID | 8990228 |
| Molecular Formula | C12H13ClN4O4 |
| Molecular Weight | 312.71 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | N'-[(Z)-[4-(2-amino-2-oxoethoxy)-3-chlorophenyl]methylideneamino]-N-methyloxamide |
| SMILES | CNC(=O)C(=O)N/N=C\c1ccc(OCC(N)=O)c(Cl)c1 |
| InChI | InChI=1S/C12H13ClN4O4/c1-15-11(19)12(20)17-16-5-7-2-3-9(8(13)4-7)21-6-10(14)18/h2-5H,6H2,1H3,(H2,14,18)(H,15,19)(H,17,20)/b16-5- |
| InChIKey | VFGOEYJOYYQGPU-BNCCVWRVSA-N |
| XLogP | -0.60 |
| TPSA | 122.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.71 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|