C18H16Cl2N4O5 — CID 19658472
N'-[(E)-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylideneamino]-N-(3,4-dichlorophenyl)oxamide (PubChem CID 19658472) has the molecular formula C18H16Cl2N4O5 and a molecular weight of 439.26 g/mol. Its IUPAC name is N'-[(E)-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylideneamino]-N-(3,4-dichlorophenyl)oxamide.
| Compound Name | N'-[(E)-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylideneamino]-N-(3,4-dichlorophenyl)oxamide |
|---|---|
| PubChem CID | 19658472 |
| Molecular Formula | C18H16Cl2N4O5 |
| Molecular Weight | 439.26 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | N'-[(E)-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]methylideneamino]-N-(3,4-dichlorophenyl)oxamide |
| SMILES | COc1cc(/C=N/NC(=O)C(=O)Nc2ccc(Cl)c(Cl)c2)ccc1OCC(N)=O |
| InChI | InChI=1S/C18H16Cl2N4O5/c1-28-15-6-10(2-5-14(15)29-9-16(21)25)8-22-24-18(27)17(26)23-11-3-4-12(19)13(20)7-11/h2-8H,9H2,1H3,(H2,21,25)(H,23,26)(H,24,27)/b22-8+ |
| InChIKey | JOVVTEGJMSYIHD-GZIVZEMBSA-N |
| XLogP | 1.95 |
| TPSA | 132.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|