C24H19Cl2N3O6 — CID 4687974
[4-[[[2-(3,4-dichloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 3,4-dimethoxybenzoate (PubChem CID 4687974) has the molecular formula C24H19Cl2N3O6 and a molecular weight of 516.34 g/mol. Its IUPAC name is [4-[[[2-(3,4-dichloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 3,4-dimethoxybenzoate.
| Compound Name | [4-[[[2-(3,4-dichloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 4687974 |
| Molecular Formula | C24H19Cl2N3O6 |
| Molecular Weight | 516.34 g/mol |
| Exact Mass | 515.07 |
| IUPAC Name | [4-[[[2-(3,4-dichloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(C=NNC(=O)C(=O)Nc3ccc(Cl)c(Cl)c3)cc2)cc1OC |
| InChI | InChI=1S/C24H19Cl2N3O6/c1-33-20-10-5-15(11-21(20)34-2)24(32)35-17-7-3-14(4-8-17)13-27-29-23(31)22(30)28-16-6-9-18(25)19(26)12-16/h3-13H,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | XGJHKTNXTZWHAR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.34 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|