C19H18ClN3O6 — CID 94832891
methyl 2-[4-[(Z)-[[2-(3-chloro-4-methoxyanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 94832891) has the molecular formula C19H18ClN3O6 and a molecular weight of 419.82 g/mol. Its IUPAC name is methyl 2-[4-[(Z)-[[2-(3-chloro-4-methoxyanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[4-[(Z)-[[2-(3-chloro-4-methoxyanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 94832891 |
| Molecular Formula | C19H18ClN3O6 |
| Molecular Weight | 419.82 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | methyl 2-[4-[(Z)-[[2-(3-chloro-4-methoxyanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(/C=N\NC(=O)C(=O)Nc2ccc(OC)c(Cl)c2)cc1 |
| InChI | InChI=1S/C19H18ClN3O6/c1-27-16-8-5-13(9-15(16)20)22-18(25)19(26)23-21-10-12-3-6-14(7-4-12)29-11-17(24)28-2/h3-10H,11H2,1-2H3,(H,22,25)(H,23,26)/b21-10- |
| InChIKey | RMVXRTMKLXFVES-FBHDLOMBSA-N |
| XLogP | 1.99 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.82 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|