C25H21Cl2N3O6 — CID 3451481
[4-[[[2-(3,4-dichloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-methoxybenzoate (PubChem CID 3451481) has the molecular formula C25H21Cl2N3O6 and a molecular weight of 530.36 g/mol. Its IUPAC name is [4-[[[2-(3,4-dichloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-methoxybenzoate.
| Compound Name | [4-[[[2-(3,4-dichloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 3451481 |
| Molecular Formula | C25H21Cl2N3O6 |
| Molecular Weight | 530.36 g/mol |
| Exact Mass | 529.08 |
| IUPAC Name | [4-[[[2-(3,4-dichloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-methoxybenzoate |
| SMILES | CCOc1cc(C=NNC(=O)C(=O)Nc2ccc(Cl)c(Cl)c2)ccc1OC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H21Cl2N3O6/c1-3-35-22-12-15(4-11-21(22)36-25(33)16-5-8-18(34-2)9-6-16)14-28-30-24(32)23(31)29-17-7-10-19(26)20(27)13-17/h4-14H,3H2,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | VTTQWJVPSDZLGM-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.36 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|