C25H22Cl2N2O6 — CID 3789851
[4-[[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-methoxybenzoate (PubChem CID 3789851) has the molecular formula C25H22Cl2N2O6 and a molecular weight of 517.37 g/mol. Its IUPAC name is [4-[[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-methoxybenzoate.
| Compound Name | [4-[[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 3789851 |
| Molecular Formula | C25H22Cl2N2O6 |
| Molecular Weight | 517.37 g/mol |
| Exact Mass | 516.09 |
| IUPAC Name | [4-[[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 4-methoxybenzoate |
| SMILES | CCOc1cc(C=NNC(=O)COc2ccc(Cl)cc2Cl)ccc1OC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H22Cl2N2O6/c1-3-33-23-12-16(4-10-22(23)35-25(31)17-5-8-19(32-2)9-6-17)14-28-29-24(30)15-34-21-11-7-18(26)13-20(21)27/h4-14H,3,15H2,1-2H3,(H,29,30) |
| InChIKey | OWUKPRMBRTUDCY-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.37 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|