C26H25ClN4O4 — CID 126163043
N'-[(Z)-[3-chloro-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2-phenylethyl)oxamide (PubChem CID 126163043) has the molecular formula C26H25ClN4O4 and a molecular weight of 492.96 g/mol. Its IUPAC name is N'-[(Z)-[3-chloro-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2-phenylethyl)oxamide.
| Compound Name | N'-[(Z)-[3-chloro-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2-phenylethyl)oxamide |
|---|---|
| PubChem CID | 126163043 |
| Molecular Formula | C26H25ClN4O4 |
| Molecular Weight | 492.96 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | N'-[(Z)-[3-chloro-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-(2-phenylethyl)oxamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(/C=N\NC(=O)C(=O)NCCc3ccccc3)cc2Cl)cc1 |
| InChI | InChI=1S/C26H25ClN4O4/c1-18-7-10-21(11-8-18)30-24(32)17-35-23-12-9-20(15-22(23)27)16-29-31-26(34)25(33)28-14-13-19-5-3-2-4-6-19/h2-12,15-16H,13-14,17H2,1H3,(H,28,33)(H,30,32)(H,31,34)/b29-16- |
| InChIKey | UJUSEJCGJWWULV-MWLSYYOVSA-N |
| XLogP | 3.47 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.96 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|