C19H30ClN3OS — CID 110508681
1-[(E)-(3-chloro-4-nonoxyphenyl)methylideneamino]-3-ethylthiourea (PubChem CID 110508681) has the molecular formula C19H30ClN3OS and a molecular weight of 383.99 g/mol. Its IUPAC name is 1-[(E)-(3-chloro-4-nonoxyphenyl)methylideneamino]-3-ethylthiourea.
| Compound Name | 1-[(E)-(3-chloro-4-nonoxyphenyl)methylideneamino]-3-ethylthiourea |
|---|---|
| PubChem CID | 110508681 |
| Molecular Formula | C19H30ClN3OS |
| Molecular Weight | 383.99 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 1-[(E)-(3-chloro-4-nonoxyphenyl)methylideneamino]-3-ethylthiourea |
| SMILES | CCCCCCCCCOc1ccc(/C=N/NC(=S)NCC)cc1Cl |
| InChI | InChI=1S/C19H30ClN3OS/c1-3-5-6-7-8-9-10-13-24-18-12-11-16(14-17(18)20)15-22-23-19(25)21-4-2/h11-12,14-15H,3-10,13H2,1-2H3,(H2,21,23,25)/b22-15+ |
| InChIKey | KICOZVAWMFZWKB-PXLXIMEGSA-N |
| XLogP | 5.29 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.99 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|