C13H18ClN3OS — CID 3910074
1-[(3-chloro-4-propan-2-yloxyphenyl)methylideneamino]-3-ethylthiourea (PubChem CID 3910074) has the molecular formula C13H18ClN3OS and a molecular weight of 299.83 g/mol. Its IUPAC name is 1-[(3-chloro-4-propan-2-yloxyphenyl)methylideneamino]-3-ethylthiourea.
| Compound Name | 1-[(3-chloro-4-propan-2-yloxyphenyl)methylideneamino]-3-ethylthiourea |
|---|---|
| PubChem CID | 3910074 |
| Molecular Formula | C13H18ClN3OS |
| Molecular Weight | 299.83 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 1-[(3-chloro-4-propan-2-yloxyphenyl)methylideneamino]-3-ethylthiourea |
| SMILES | CCNC(=S)NN=Cc1ccc(OC(C)C)c(Cl)c1 |
| InChI | InChI=1S/C13H18ClN3OS/c1-4-15-13(19)17-16-8-10-5-6-12(11(14)7-10)18-9(2)3/h5-9H,4H2,1-3H3,(H2,15,17,19) |
| InChIKey | UCZNANWNYAINCF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.83 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|