C20H23FN4O3S — CID 7933596
2-[2-ethoxy-4-[(Z)-[(2-fluorophenyl)carbamothioylhydrazinylidene]methyl]phenoxy]-N,N-dimethylacetamide (PubChem CID 7933596) has the molecular formula C20H23FN4O3S and a molecular weight of 418.49 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(Z)-[(2-fluorophenyl)carbamothioylhydrazinylidene]methyl]phenoxy]-N,N-dimethylacetamide.
| Compound Name | 2-[2-ethoxy-4-[(Z)-[(2-fluorophenyl)carbamothioylhydrazinylidene]methyl]phenoxy]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 7933596 |
| Molecular Formula | C20H23FN4O3S |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 2-[2-ethoxy-4-[(Z)-[(2-fluorophenyl)carbamothioylhydrazinylidene]methyl]phenoxy]-N,N-dimethylacetamide |
| SMILES | CCOc1cc(/C=N\NC(=S)Nc2ccccc2F)ccc1OCC(=O)N(C)C |
| InChI | InChI=1S/C20H23FN4O3S/c1-4-27-18-11-14(9-10-17(18)28-13-19(26)25(2)3)12-22-24-20(29)23-16-8-6-5-7-15(16)21/h5-12H,4,13H2,1-3H3,(H2,23,24,29)/b22-12- |
| InChIKey | NGRYCVWAGLETAE-UUYOSTAYSA-N |
| XLogP | 3.01 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|