C17H25ClN4O2S — CID 110508469
1-[(E)-(3-chloro-4-propoxyphenyl)methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea (PubChem CID 110508469) has the molecular formula C17H25ClN4O2S and a molecular weight of 384.93 g/mol. Its IUPAC name is 1-[(E)-(3-chloro-4-propoxyphenyl)methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-[(E)-(3-chloro-4-propoxyphenyl)methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 110508469 |
| Molecular Formula | C17H25ClN4O2S |
| Molecular Weight | 384.93 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 1-[(E)-(3-chloro-4-propoxyphenyl)methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea |
| SMILES | CCCOc1ccc(/C=N/NC(=S)NCCN2CCOCC2)cc1Cl |
| InChI | InChI=1S/C17H25ClN4O2S/c1-2-9-24-16-4-3-14(12-15(16)18)13-20-21-17(25)19-5-6-22-7-10-23-11-8-22/h3-4,12-13H,2,5-11H2,1H3,(H2,19,21,25)/b20-13+ |
| InChIKey | YJNAJHKVBSZFGM-DEDYPNTBSA-N |
| XLogP | 2.26 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.93 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|