C14H18Cl2N4O2S — CID 135731420
1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea (PubChem CID 135731420) has the molecular formula C14H18Cl2N4O2S and a molecular weight of 377.30 g/mol. Its IUPAC name is 1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 135731420 |
| Molecular Formula | C14H18Cl2N4O2S |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea |
| SMILES | Oc1c(Cl)cc(Cl)cc1/C=N/NC(=S)NCCN1CCOCC1 |
| InChI | InChI=1S/C14H18Cl2N4O2S/c15-11-7-10(13(21)12(16)8-11)9-18-19-14(23)17-1-2-20-3-5-22-6-4-20/h7-9,21H,1-6H2,(H2,17,19,23)/b18-9+ |
| InChIKey | SJKDNFNSEAOXLN-GIJQJNRQSA-N |
| XLogP | 1.83 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|