C13H15Cl2N3O3 — CID 137077970
N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-morpholin-4-ylacetamide (PubChem CID 137077970) has the molecular formula C13H15Cl2N3O3 and a molecular weight of 332.19 g/mol. Its IUPAC name is N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-morpholin-4-ylacetamide.
| Compound Name | N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 137077970 |
| Molecular Formula | C13H15Cl2N3O3 |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | N-[(Z)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-2-morpholin-4-ylacetamide |
| SMILES | O=C(CN1CCOCC1)N/N=C\c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C13H15Cl2N3O3/c14-10-5-9(13(20)11(15)6-10)7-16-17-12(19)8-18-1-3-21-4-2-18/h5-7,20H,1-4,8H2,(H,17,19)/b16-7- |
| InChIKey | PJPZTRVHRVOUFK-APSNUPSMSA-N |
| XLogP | 1.48 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|