C15H20ClN3O4 — CID 6877310
N-[(E)-(2-chloro-4,5-dimethoxyphenyl)methylideneamino]-2-morpholin-4-ylacetamide (PubChem CID 6877310) has the molecular formula C15H20ClN3O4 and a molecular weight of 341.80 g/mol. Its IUPAC name is N-[(E)-(2-chloro-4,5-dimethoxyphenyl)methylideneamino]-2-morpholin-4-ylacetamide.
| Compound Name | N-[(E)-(2-chloro-4,5-dimethoxyphenyl)methylideneamino]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 6877310 |
| Molecular Formula | C15H20ClN3O4 |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | N-[(E)-(2-chloro-4,5-dimethoxyphenyl)methylideneamino]-2-morpholin-4-ylacetamide |
| SMILES | COc1cc(Cl)c(/C=N/NC(=O)CN2CCOCC2)cc1OC |
| InChI | InChI=1S/C15H20ClN3O4/c1-21-13-7-11(12(16)8-14(13)22-2)9-17-18-15(20)10-19-3-5-23-6-4-19/h7-9H,3-6,10H2,1-2H3,(H,18,20)/b17-9+ |
| InChIKey | WKEDIALPWYAFBJ-RQZCQDPDSA-N |
| XLogP | 1.14 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|