C13H14Cl3N3O2 — CID 126007489
2-morpholin-4-yl-N-[(E)-(2,3,5-trichlorophenyl)methylideneamino]acetamide (PubChem CID 126007489) has the molecular formula C13H14Cl3N3O2 and a molecular weight of 350.63 g/mol. Its IUPAC name is 2-morpholin-4-yl-N-[(E)-(2,3,5-trichlorophenyl)methylideneamino]acetamide.
| Compound Name | 2-morpholin-4-yl-N-[(E)-(2,3,5-trichlorophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126007489 |
| Molecular Formula | C13H14Cl3N3O2 |
| Molecular Weight | 350.63 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | 2-morpholin-4-yl-N-[(E)-(2,3,5-trichlorophenyl)methylideneamino]acetamide |
| SMILES | O=C(CN1CCOCC1)N/N=C/c1cc(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C13H14Cl3N3O2/c14-10-5-9(13(16)11(15)6-10)7-17-18-12(20)8-19-1-3-21-4-2-19/h5-7H,1-4,8H2,(H,18,20)/b17-7+ |
| InChIKey | NNPVQVZUIJQDHM-REZTVBANSA-N |
| XLogP | 2.43 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.63 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|