C13H16IN3O4 — CID 137121122
N-[(E)-(2,4-dihydroxy-5-iodophenyl)methylideneamino]-2-morpholin-4-ylacetamide (PubChem CID 137121122) has the molecular formula C13H16IN3O4 and a molecular weight of 405.19 g/mol. Its IUPAC name is N-[(E)-(2,4-dihydroxy-5-iodophenyl)methylideneamino]-2-morpholin-4-ylacetamide.
| Compound Name | N-[(E)-(2,4-dihydroxy-5-iodophenyl)methylideneamino]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 137121122 |
| Molecular Formula | C13H16IN3O4 |
| Molecular Weight | 405.19 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | N-[(E)-(2,4-dihydroxy-5-iodophenyl)methylideneamino]-2-morpholin-4-ylacetamide |
| SMILES | O=C(CN1CCOCC1)N/N=C/c1cc(I)c(O)cc1O |
| InChI | InChI=1S/C13H16IN3O4/c14-10-5-9(11(18)6-12(10)19)7-15-16-13(20)8-17-1-3-21-4-2-17/h5-7,18-19H,1-4,8H2,(H,16,20)/b15-7+ |
| InChIKey | XFWMVMAGBUQNLC-VIZOYTHASA-N |
| XLogP | 0.48 |
| TPSA | 94.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.19 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|