C13H15IN4O5 — CID 137064455
N-[(Z)-(4-hydroxy-3-iodo-5-nitrophenyl)methylideneamino]-2-morpholin-4-ylacetamide (PubChem CID 137064455) has the molecular formula C13H15IN4O5 and a molecular weight of 434.19 g/mol. Its IUPAC name is N-[(Z)-(4-hydroxy-3-iodo-5-nitrophenyl)methylideneamino]-2-morpholin-4-ylacetamide.
| Compound Name | N-[(Z)-(4-hydroxy-3-iodo-5-nitrophenyl)methylideneamino]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 137064455 |
| Molecular Formula | C13H15IN4O5 |
| Molecular Weight | 434.19 g/mol |
| Exact Mass | 434.01 |
| IUPAC Name | N-[(Z)-(4-hydroxy-3-iodo-5-nitrophenyl)methylideneamino]-2-morpholin-4-ylacetamide |
| SMILES | O=C(CN1CCOCC1)N/N=C\c1cc(I)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H15IN4O5/c14-10-5-9(6-11(13(10)20)18(21)22)7-15-16-12(19)8-17-1-3-23-4-2-17/h5-7,20H,1-4,8H2,(H,16,19)/b15-7- |
| InChIKey | TWQNUBOQYFEFLM-CHHVJCJISA-N |
| XLogP | 0.69 |
| TPSA | 117.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.19 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|