C20H20BrIN4O5 — CID 124533859
N-[(E)-[3-bromo-5-iodo-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-morpholin-4-ylacetamide (PubChem CID 124533859) has the molecular formula C20H20BrIN4O5 and a molecular weight of 603.21 g/mol. Its IUPAC name is N-[(E)-[3-bromo-5-iodo-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-morpholin-4-ylacetamide.
| Compound Name | N-[(E)-[3-bromo-5-iodo-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 124533859 |
| Molecular Formula | C20H20BrIN4O5 |
| Molecular Weight | 603.21 g/mol |
| Exact Mass | 601.97 |
| IUPAC Name | N-[(E)-[3-bromo-5-iodo-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-morpholin-4-ylacetamide |
| SMILES | O=C(CN1CCOCC1)N/N=C/c1cc(Br)c(OCc2cccc([N+](=O)[O-])c2)c(I)c1 |
| InChI | InChI=1S/C20H20BrIN4O5/c21-17-9-15(11-23-24-19(27)12-25-4-6-30-7-5-25)10-18(22)20(17)31-13-14-2-1-3-16(8-14)26(28)29/h1-3,8-11H,4-7,12-13H2,(H,24,27)/b23-11+ |
| InChIKey | VJBMBTBFLSCWJF-FOKLQQMPSA-N |
| XLogP | 3.32 |
| TPSA | 106.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.21 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|