C23H13Br2I2N3O5 — CID 21375863
5,7-dibromo-N-[(Z)-[3,5-diiodo-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 21375863) has the molecular formula C23H13Br2I2N3O5 and a molecular weight of 824.99 g/mol. Its IUPAC name is 5,7-dibromo-N-[(Z)-[3,5-diiodo-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5,7-dibromo-N-[(Z)-[3,5-diiodo-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 21375863 |
| Molecular Formula | C23H13Br2I2N3O5 |
| Molecular Weight | 824.99 g/mol |
| Exact Mass | 822.73 |
| IUPAC Name | 5,7-dibromo-N-[(Z)-[3,5-diiodo-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | O=C(N/N=C\c1cc(I)c(OCc2cccc([N+](=O)[O-])c2)c(I)c1)c1cc2cc(Br)cc(Br)c2o1 |
| InChI | InChI=1S/C23H13Br2I2N3O5/c24-15-7-14-8-20(35-21(14)17(25)9-15)23(31)29-28-10-13-5-18(26)22(19(27)6-13)34-11-12-2-1-3-16(4-12)30(32)33/h1-10H,11H2,(H,29,31)/b28-10- |
| InChIKey | YKQWDPPMKZCYFD-LGUSAWBASA-N |
| XLogP | 7.42 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.99 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|