C16H8Br2ClN3O4 — CID 21375573
5,7-dibromo-N-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 21375573) has the molecular formula C16H8Br2ClN3O4 and a molecular weight of 501.52 g/mol. Its IUPAC name is 5,7-dibromo-N-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5,7-dibromo-N-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 21375573 |
| Molecular Formula | C16H8Br2ClN3O4 |
| Molecular Weight | 501.52 g/mol |
| Exact Mass | 498.86 |
| IUPAC Name | 5,7-dibromo-N-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | O=C(N/N=C\c1cc([N+](=O)[O-])ccc1Cl)c1cc2cc(Br)cc(Br)c2o1 |
| InChI | InChI=1S/C16H8Br2ClN3O4/c17-10-3-8-5-14(26-15(8)12(18)6-10)16(23)21-20-7-9-4-11(22(24)25)1-2-13(9)19/h1-7H,(H,21,23)/b20-7- |
| InChIKey | MDNACDFVUMCCLV-SCDVKCJHSA-N |
| XLogP | 5.28 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.52 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|