C18H13Br2N3O6 — CID 135563379
5,7-dibromo-N-[(Z)-(3-ethoxy-2-hydroxy-5-nitrophenyl)methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 135563379) has the molecular formula C18H13Br2N3O6 and a molecular weight of 527.13 g/mol. Its IUPAC name is 5,7-dibromo-N-[(Z)-(3-ethoxy-2-hydroxy-5-nitrophenyl)methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5,7-dibromo-N-[(Z)-(3-ethoxy-2-hydroxy-5-nitrophenyl)methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 135563379 |
| Molecular Formula | C18H13Br2N3O6 |
| Molecular Weight | 527.13 g/mol |
| Exact Mass | 524.92 |
| IUPAC Name | 5,7-dibromo-N-[(Z)-(3-ethoxy-2-hydroxy-5-nitrophenyl)methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | CCOc1cc([N+](=O)[O-])cc(/C=N\NC(=O)c2cc3cc(Br)cc(Br)c3o2)c1O |
| InChI | InChI=1S/C18H13Br2N3O6/c1-2-28-14-7-12(23(26)27)4-10(16(14)24)8-21-22-18(25)15-5-9-3-11(19)6-13(20)17(9)29-15/h3-8,24H,2H2,1H3,(H,22,25)/b21-8- |
| InChIKey | LWQZZRBKUAFCBK-WNFQYIGGSA-N |
| XLogP | 4.73 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.13 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|