C25H17Br3Cl2N2O4 — CID 21376152
5,7-dibromo-N-[(Z)-[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 21376152) has the molecular formula C25H17Br3Cl2N2O4 and a molecular weight of 720.04 g/mol. Its IUPAC name is 5,7-dibromo-N-[(Z)-[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5,7-dibromo-N-[(Z)-[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 21376152 |
| Molecular Formula | C25H17Br3Cl2N2O4 |
| Molecular Weight | 720.04 g/mol |
| Exact Mass | 715.81 |
| IUPAC Name | 5,7-dibromo-N-[(Z)-[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)c2cc3cc(Br)cc(Br)c3o2)c(Br)cc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H17Br3Cl2N2O4/c1-2-34-21-7-15(18(27)10-22(21)35-12-13-3-4-17(29)9-20(13)30)11-31-32-25(33)23-6-14-5-16(26)8-19(28)24(14)36-23/h3-11H,2,12H2,1H3,(H,32,33)/b31-11- |
| InChIKey | FURDQDINSNJNAF-VWDPFFEDSA-N |
| XLogP | 8.77 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.04 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|