C20H17Br2ClN2O4 — CID 21376254
5,7-dibromo-N-[(Z)-(2-chloro-4,5-diethoxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 21376254) has the molecular formula C20H17Br2ClN2O4 and a molecular weight of 544.63 g/mol. Its IUPAC name is 5,7-dibromo-N-[(Z)-(2-chloro-4,5-diethoxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5,7-dibromo-N-[(Z)-(2-chloro-4,5-diethoxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 21376254 |
| Molecular Formula | C20H17Br2ClN2O4 |
| Molecular Weight | 544.63 g/mol |
| Exact Mass | 541.92 |
| IUPAC Name | 5,7-dibromo-N-[(Z)-(2-chloro-4,5-diethoxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | CCOc1cc(Cl)c(/C=N\NC(=O)c2cc3cc(Br)cc(Br)c3o2)cc1OCC |
| InChI | InChI=1S/C20H17Br2ClN2O4/c1-3-27-16-7-12(15(23)9-17(16)28-4-2)10-24-25-20(26)18-6-11-5-13(21)8-14(22)19(11)29-18/h5-10H,3-4H2,1-2H3,(H,25,26)/b24-10- |
| InChIKey | MKKSNWHTZWLWCG-VROXFSQNSA-N |
| XLogP | 6.17 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.63 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|