C19H16Br2N2O5 — CID 21376244
5,7-dibromo-N-[(Z)-(2,4,5-trimethoxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 21376244) has the molecular formula C19H16Br2N2O5 and a molecular weight of 512.15 g/mol. Its IUPAC name is 5,7-dibromo-N-[(Z)-(2,4,5-trimethoxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 5,7-dibromo-N-[(Z)-(2,4,5-trimethoxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 21376244 |
| Molecular Formula | C19H16Br2N2O5 |
| Molecular Weight | 512.15 g/mol |
| Exact Mass | 509.94 |
| IUPAC Name | 5,7-dibromo-N-[(Z)-(2,4,5-trimethoxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | COc1cc(OC)c(OC)cc1/C=N\NC(=O)c1cc2cc(Br)cc(Br)c2o1 |
| InChI | InChI=1S/C19H16Br2N2O5/c1-25-14-8-16(27-3)15(26-2)6-11(14)9-22-23-19(24)17-5-10-4-12(20)7-13(21)18(10)28-17/h4-9H,1-3H3,(H,23,24)/b22-9- |
| InChIKey | LAHOTRGIWZZMIG-AFPJDJCSSA-N |
| XLogP | 4.75 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.15 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|