C21H17Br3N2O6 — CID 21375965
ethyl 2-[5-bromo-4-[(Z)-[(5,7-dibromo-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenoxy]acetate (PubChem CID 21375965) has the molecular formula C21H17Br3N2O6 and a molecular weight of 633.09 g/mol. Its IUPAC name is ethyl 2-[5-bromo-4-[(Z)-[(5,7-dibromo-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[5-bromo-4-[(Z)-[(5,7-dibromo-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 21375965 |
| Molecular Formula | C21H17Br3N2O6 |
| Molecular Weight | 633.09 g/mol |
| Exact Mass | 629.86 |
| IUPAC Name | ethyl 2-[5-bromo-4-[(Z)-[(5,7-dibromo-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]-2-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1cc(Br)c(/C=N\NC(=O)c2cc3cc(Br)cc(Br)c3o2)cc1OC |
| InChI | InChI=1S/C21H17Br3N2O6/c1-3-30-19(27)10-31-17-8-14(23)12(6-16(17)29-2)9-25-26-21(28)18-5-11-4-13(22)7-15(24)20(11)32-18/h4-9H,3,10H2,1-2H3,(H,26,28)/b25-9- |
| InChIKey | XVSXDINSYDAIJV-MWYAZZEHSA-N |
| XLogP | 5.43 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.09 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|