C24H25BrN2O7 — CID 126341664
ethyl 2-[5-bromo-2-ethoxy-4-[(E)-[(5-ethoxy-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 126341664) has the molecular formula C24H25BrN2O7 and a molecular weight of 533.38 g/mol. Its IUPAC name is ethyl 2-[5-bromo-2-ethoxy-4-[(E)-[(5-ethoxy-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[5-bromo-2-ethoxy-4-[(E)-[(5-ethoxy-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126341664 |
| Molecular Formula | C24H25BrN2O7 |
| Molecular Weight | 533.38 g/mol |
| Exact Mass | 532.08 |
| IUPAC Name | ethyl 2-[5-bromo-2-ethoxy-4-[(E)-[(5-ethoxy-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1cc(Br)c(/C=N/NC(=O)c2cc3cc(OCC)ccc3o2)cc1OCC |
| InChI | InChI=1S/C24H25BrN2O7/c1-4-30-17-7-8-19-15(9-17)10-22(34-19)24(29)27-26-13-16-11-20(31-5-2)21(12-18(16)25)33-14-23(28)32-6-3/h7-13H,4-6,14H2,1-3H3,(H,27,29)/b26-13+ |
| InChIKey | JMORCNXPFNLVNG-LGJNPRDNSA-N |
| XLogP | 4.70 |
| TPSA | 108.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.38 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|