C26H20BrClFN3O5 — CID 126023586
N-[(E)-[2-bromo-5-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-5-chloro-1-benzofuran-2-carboxamide (PubChem CID 126023586) has the molecular formula C26H20BrClFN3O5 and a molecular weight of 588.82 g/mol. Its IUPAC name is N-[(E)-[2-bromo-5-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-5-chloro-1-benzofuran-2-carboxamide.
| Compound Name | N-[(E)-[2-bromo-5-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-5-chloro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126023586 |
| Molecular Formula | C26H20BrClFN3O5 |
| Molecular Weight | 588.82 g/mol |
| Exact Mass | 587.03 |
| IUPAC Name | N-[(E)-[2-bromo-5-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]methylideneamino]-5-chloro-1-benzofuran-2-carboxamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2cc3cc(Cl)ccc3o2)c(Br)cc1OCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C26H20BrClFN3O5/c1-2-35-22-11-16(13-30-32-26(34)24-10-15-9-17(28)3-8-21(15)37-24)20(27)12-23(22)36-14-25(33)31-19-6-4-18(29)5-7-19/h3-13H,2,14H2,1H3,(H,31,33)(H,32,34)/b30-13+ |
| InChIKey | CVLLRXWXIXNHHO-VVEOGCPPSA-N |
| XLogP | 6.17 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.82 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|